cas: 627836-23-1 — see every product listed under this CAS number, including other names
6-Amino-N,N-dimethylpyridine-3-sulfonamide 95% (CAS 627836-23-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A481902-100mg |
| cas | 627836-23-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1977.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A481902 |
6-amino-N,N-dimethylpyridine-3-sulfonamide (CAS 627836-23-1) is a chemical compound with the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. IUPAC name: 6-amino-N,N-dimethylpyridine-3-sulfonamide. InChIKey: OLFVKJUZBCQROA-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 6-amino-N,N-dimethylpyridine-3-sulfonamide |
| InChIKey | OLFVKJUZBCQROA-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CN=C(C=C1)N |
Computed by PubChem (NCBI)