cas: 1620515-86-7 — see every product listed under this CAS number, including other names
6-BROMO-7-METHOXYQUINOLINE, 98% (CAS 1620515-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F500892-100MG |
| cas | 1620515-86-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 721.64 Pln | |
| Fluorochem | 2.5g | 1705.67 Pln | |
| Fluorochem | 5g | 2236.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-7-methoxyquinoline (CAS 1620515-86-7) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 6-bromo-7-methoxyquinoline. InChIKey: UACHUBQTGCSWOR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 6-bromo-7-methoxyquinoline |
| InChIKey | UACHUBQTGCSWOR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=CC=NC2=C1)Br |
Computed by PubChem (NCBI)