cas: 914612-23-0 — see every product listed under this CAS number, including other names
6-Benzyl-4-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine 98% (CAS 914612-23-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A306081-100mg |
| cas | 914612-23-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 1927.88 Pln | |
| Ambeed | 10g | 3346.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A306081 |
6-benzyl-4-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (CAS 914612-23-0) is a chemical compound with the molecular formula C14H14ClN3 and a molecular weight of 259.73 g/mol. IUPAC name: 6-benzyl-4-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine. InChIKey: RPJAAZOTUXKSEV-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 6-benzyl-4-chloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| InChIKey | RPJAAZOTUXKSEV-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1N=CN=C2Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)