CAS 876728-35-7 appears in our catalog under these names: 6-Bromo-1,4-dimethyl-1,2,3,4-tetrahydroquinoxaline, 97% , 6-Bromo-1,4-dimethyl-1,2,3,4-tetrahydroquinoxaline, 98%, 98%. Offered by: Thermo Scientific, Chemat. Available pack sizes: 250MG, 1g, 50mg.
6-bromo-1,4-dimethyl-2,3-dihydroquinoxaline (CAS 876728-35-7) is a chemical compound with the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. IUPAC name: 6-bromo-1,4-dimethyl-2,3-dihydroquinoxaline. InChIKey: BVWZHBZUOICVIU-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | 6-bromo-1,4-dimethyl-2,3-dihydroquinoxaline |
| InChIKey | BVWZHBZUOICVIU-UHFFFAOYSA-N |
| SMILES | CN1CCN(C2=C1C=CC(=C2)Br)C |
Computed by PubChem (NCBI)