6-Bromo-2,3-difluorobenzyl methanesulfonate, 98%
cas: 1823323-24-5 — see every product listed under this CAS number, including other names
6-Bromo-2,3-difluorobenzyl methanesulfonate, 98% (CAS 1823323-24-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1899430-250mg |
| cas | 1823323-24-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1688.69 Pln | |
| Ambeed | 10g | 2829.00 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 603.15 Pln | |
| BLDpharm | 5g | 1819.38 Pln | |
| BLDpharm | 10g | 3046.73 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(6-bromo-2,3-difluorophenyl)methyl methanesulfonate (CAS 1823323-24-5) is a chemical compound with the molecular formula C8H7BrF2O3S and a molecular weight of 301.11 g/mol. IUPAC name: (6-bromo-2,3-difluorophenyl)methyl methanesulfonate. InChIKey: JWJBNUQVODEFLG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O3S |
|---|---|
| Molecular weight | 301.11 g/mol |
| IUPAC name | (6-bromo-2,3-difluorophenyl)methyl methanesulfonate |
| InChIKey | JWJBNUQVODEFLG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1=C(C=CC(=C1F)F)Br |
Computed by PubChem (NCBI)
