cas: 73568-35-1 — see every product listed under this CAS number, including other names
6-Bromo-2-Chloroquinoline-3-Carbaldehyde, 97%, 97% (CAS 73568-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116MOI-100mg |
| cas | 73568-35-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 314.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-chloroquinoline-3-carbaldehyde (CAS 73568-35-1) is a chemical compound with the molecular formula C10H5BrClNO and a molecular weight of 270.51 g/mol. IUPAC name: 6-bromo-2-chloroquinoline-3-carbaldehyde. InChIKey: DCZCMZVZWKXJAF-UHFFFAOYSA-N.
| Molecular formula | C10H5BrClNO |
|---|---|
| Molecular weight | 270.51 g/mol |
| IUPAC name | 6-bromo-2-chloroquinoline-3-carbaldehyde |
| InChIKey | DCZCMZVZWKXJAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Br)C=O)Cl |
Computed by PubChem (NCBI)