cas: 113092-96-9 — see every product listed under this CAS number, including other names
6-Bromo-2-chloro-3-methylquinoline, 98%, 98% (CAS 113092-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SI7-100mg |
| cas | 113092-96-9 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1494.80 Pln | |
| Chemat | 25g | 5882.00 Pln | |
| Chemat | 100g | 16610.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-chloro-3-methylquinoline (CAS 113092-96-9) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 6-bromo-2-chloro-3-methylquinoline. InChIKey: VKGSTGZYRFTWNA-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 6-bromo-2-chloro-3-methylquinoline |
| InChIKey | VKGSTGZYRFTWNA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Br)N=C1Cl |
Computed by PubChem (NCBI)