cas: 99465-04-0 — see every product listed under this CAS number, including other names
6-Bromo-2-chloroquinoline-3-carbonitrile 95% (CAS 99465-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A783603-250mg |
| cas | 99465-04-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 637.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A783603 |
6-bromo-2-chloroquinoline-3-carbonitrile (CAS 99465-04-0) is a chemical compound with the molecular formula C10H4BrClN2 and a molecular weight of 267.51 g/mol. IUPAC name: 6-bromo-2-chloroquinoline-3-carbonitrile. InChIKey: FFAIUVQNAJQHTR-UHFFFAOYSA-N.
| Molecular formula | C10H4BrClN2 |
|---|---|
| Molecular weight | 267.51 g/mol |
| IUPAC name | 6-bromo-2-chloroquinoline-3-carbonitrile |
| InChIKey | FFAIUVQNAJQHTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Br)C#N)Cl |
Computed by PubChem (NCBI)