6-Bromo-4-oxothiochromane-2-carboxylic acid, 95%
cas: 1958099-19-8 — see every product listed under this CAS number, including other names
6-Bromo-4-oxothiochromane-2-carboxylic acid, 95% (CAS 1958099-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A820992-100mg |
| cas | 1958099-19-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 664.40 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 964.13 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-bromo-4-oxo-2,3-dihydrothiochromene-2-carboxylic acid (CAS 1958099-19-8) is a chemical compound with the molecular formula C10H7BrO3S and a molecular weight of 287.13 g/mol. IUPAC name: 6-bromo-4-oxo-2,3-dihydrothiochromene-2-carboxylic acid. InChIKey: WJKLDGDSRJNIJO-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3S |
|---|---|
| Molecular weight | 287.13 g/mol |
| IUPAC name | 6-bromo-4-oxo-2,3-dihydrothiochromene-2-carboxylic acid |
| InChIKey | WJKLDGDSRJNIJO-UHFFFAOYSA-N |
| SMILES | C1C(SC2=C(C1=O)C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)