cas: 94025-76-0 — see every product listed under this CAS number, including other names
6-Bromo-4-phenyl-3,4-dihydroquinolin-2(1H)-one, 95%, 95% (CAS 94025-76-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N5I-100mg |
| cas | 94025-76-0 |
| size | 100mg |
| availability | 1.23g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one (CAS 94025-76-0) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: 6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one. InChIKey: NGZWCCIWYKYWDL-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | 6-bromo-4-phenyl-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | NGZWCCIWYKYWDL-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C=CC(=C2)Br)NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)