cas: 106103-36-0 — see every product listed under this CAS number, including other names
6-Bromo-5-methoxy-1H-indole, 97% (CAS 106103-36-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235314-100MG |
| cas | 106103-36-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 500mg | 726.85 Pln | |
| Fluorochem | 1g | 1060.06 Pln | |
| Fluorochem | 5g | 3012.50 Pln | |
| Fluorochem | 10g | 5277.33 Pln | |
| Fluorochem | 25g | 10504.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-5-methoxy-1H-indole (CAS 106103-36-0) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-5-methoxy-1H-indole. InChIKey: LYRDXFOLYOIABR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1H-indole |
| InChIKey | LYRDXFOLYOIABR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN2)Br |
Computed by PubChem (NCBI)