6-Bromoquinoline-2-carbaldehyde, 98%
cas: 98948-91-5 — see every product listed under this CAS number, including other names
6-Bromoquinoline-2-carbaldehyde, 98% (CAS 98948-91-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A128643-250mg |
| cas | 98948-91-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1260.38 Pln | |
| Ambeed | 5g | 4709.12 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 995.60 Pln | |
| Chemat | 5g | 2507.60 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1299.56 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1352.88 Pln | |
| BLDpharm | 5g | 5073.79 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
6-bromoquinoline-2-carbaldehyde (CAS 98948-91-5) is a chemical compound with the molecular formula C10H6BrNO and a molecular weight of 236.06 g/mol. IUPAC name: 6-bromoquinoline-2-carbaldehyde. InChIKey: VQOCWJMSBFLQKK-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO |
|---|---|
| Molecular weight | 236.06 g/mol |
| IUPAC name | 6-bromoquinoline-2-carbaldehyde |
| InChIKey | VQOCWJMSBFLQKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)C=O)C=C1Br |
Computed by PubChem (NCBI)