cas: 94205-21-7 — see every product listed under this CAS number, including other names
6-Chloro-2-oxo-4-phenyl-1,2-dihydroquinoline-3-carboxylic acid, 95%, 95% (CAS 94205-21-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHYT-100mg |
| cas | 94205-21-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1144.40 Pln | |
| Chemat | 1g | 3194.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-oxo-4-phenyl-1H-quinoline-3-carboxylic acid (CAS 94205-21-7) is a chemical compound with the molecular formula C16H10ClNO3 and a molecular weight of 299.71 g/mol. IUPAC name: 6-chloro-2-oxo-4-phenyl-1H-quinoline-3-carboxylic acid. InChIKey: DYUJVGCEPFDDFC-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO3 |
|---|---|
| Molecular weight | 299.71 g/mol |
| IUPAC name | 6-chloro-2-oxo-4-phenyl-1H-quinoline-3-carboxylic acid |
| InChIKey | DYUJVGCEPFDDFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC3=C2C=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)