cas: 2223032-34-4 — see every product listed under this CAS number, including other names
6-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinonitrile 96% (CAS 2223032-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A582684-100mg |
| cas | 2223032-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4392.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A582684 |
6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile (CAS 2223032-34-4) is a chemical compound with the molecular formula C12H14BClN2O2 and a molecular weight of 264.52 g/mol. IUPAC name: 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile. InChIKey: RXGCAGUABNZLIK-UHFFFAOYSA-N.
| Molecular formula | C12H14BClN2O2 |
|---|---|
| Molecular weight | 264.52 g/mol |
| IUPAC name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile |
| InChIKey | RXGCAGUABNZLIK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)C#N |
Computed by PubChem (NCBI)