cas: 92525-74-1 — see every product listed under this CAS number, including other names
6-Chloroquinoline-2,3-dicarboxylic acid diethyl ester, 97%, 97% (CAS 92525-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IH7T-100mg |
| cas | 92525-74-1 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 500mg | 995.60 Pln | |
| Chemat | 1g | 1653.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Diethyl 6-chloroquinoline-2,3-dicarboxylate (CAS 92525-74-1) is a chemical compound with the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. IUPAC name: diethyl 6-chloroquinoline-2,3-dicarboxylate. InChIKey: ASFMPELSGBWGAT-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4 |
|---|---|
| Molecular weight | 307.73 g/mol |
| IUPAC name | diethyl 6-chloroquinoline-2,3-dicarboxylate |
| InChIKey | ASFMPELSGBWGAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)Cl)C(=O)OCC |
Computed by PubChem (NCBI)