cas: 952402-79-8 — see every product listed under this CAS number, including other names
6-Cyanopyridine-2-boronic Acid Pinacol Ester, 95%, 95% (CAS 952402-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N87-100mg |
| cas | 952402-79-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1926.80 Pln | |
| Chemat | 25g | 7782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile (CAS 952402-79-8) is a chemical compound with the molecular formula C12H15BN2O2 and a molecular weight of 230.07 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile. InChIKey: DPFGNHMAUFKOCZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile |
| InChIKey | DPFGNHMAUFKOCZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)C#N |
Computed by PubChem (NCBI)