cas: 1260641-86-8 — see every product listed under this CAS number, including other names
6-Fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 97% (CAS 1260641-86-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224102-100MG |
| cas | 1260641-86-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 1080.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1260641-86-8) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: 6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: OXOUVNLVPPEGSB-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | 6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | OXOUVNLVPPEGSB-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)