cas: 703-67-3 — see every product listed under this CAS number, including other names
6-Fluoro-1-tetralone, 95% (CAS 703-67-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 14g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209369-250MG |
| cas | 703-67-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 14g | 940.31 Pln | |
| Fluorochem | 25g | 1632.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 703-67-3) is a chemical compound with the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: NJYZZEHPEKDFEK-UHFFFAOYSA-N.
| Molecular formula | C10H9FO |
|---|---|
| Molecular weight | 164.18 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | NJYZZEHPEKDFEK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)C(=O)C1 |
Computed by PubChem (NCBI)