6-Fluoro-1H-indole-5-carbonitrile, 97%
cas: 1427358-21-1 — see every product listed under this CAS number, including other names
6-Fluoro-1H-indole-5-carbonitrile, 97% (CAS 1427358-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A446476-250mg |
| cas | 1427358-21-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1049.00 Pln | |
| Ambeed | 1g | 2089.19 Pln | |
| Ambeed | 5g | 4831.50 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1461.20 Pln | |
| Chemat | 5g | 5229.20 Pln | |
| BLDpharm | 100mg | 703.11 Pln | |
| BLDpharm | 250mg | 1125.18 Pln | |
| BLDpharm | 1g | 2247.01 Pln | |
| BLDpharm | 5g | 5207.08 Pln | |
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 1g | 2148.22 Pln | |
| Fluorochem | 5g | 4944.11 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
6-fluoro-1H-indole-5-carbonitrile (CAS 1427358-21-1) is a chemical compound with the molecular formula C9H5FN2 and a molecular weight of 160.15 g/mol. IUPAC name: 6-fluoro-1H-indole-5-carbonitrile. InChIKey: HITOEBXXXWHQOR-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2 |
|---|---|
| Molecular weight | 160.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-5-carbonitrile |
| InChIKey | HITOEBXXXWHQOR-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)C#N)F |
Computed by PubChem (NCBI)