Products 2102174-87-6
CAS 2102174-87-6 is the registry number for 6-Fluoro-2,2-dimethyl-5-nitro-2,3-dihydrobenzofuran, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-fluoro-2,2-dimethyl-5-nitro-3H-1-benzofuran (CAS 2102174-87-6) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-5-nitro-3H-1-benzofuran. InChIKey: LQAYGBZMHMDBMG-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-5-nitro-3H-1-benzofuran |
| InChIKey | LQAYGBZMHMDBMG-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC(=C(C=C2O1)F)[N+](=O)[O-])C |
Computed by PubChem (NCBI)