cas: 1210247-51-0 — see every product listed under this CAS number, including other names
6-Fluoro-3,4-dihydro-2H-benzo(b)(1,4)oxazine hydrochloride, 97% (CAS 1210247-51-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A133125-25g |
| cas | 1210247-51-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6632.08 Pln | |
| AmBeed | 250mg | 538.72 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-fluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 1210247-51-0) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: VMPQDXMPPNCWGW-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | VMPQDXMPPNCWGW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)