6-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-((triisopropylsilyl)ethynyl)naphthalen-2-ol, 98%
cas: 2757097-49-5 — see every product listed under this CAS number, including other names
6-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-((triisopropylsilyl)ethynyl)naphthalen-2-ol, 98% (CAS 2757097-49-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1730385-250mg |
| cas | 2757097-49-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1165.81 Pln | |
| Ambeed | 5g | 3869.19 Pln | |
| Ambeed | 25g | 13776.00 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 486.52 Pln | |
| BLDpharm | 1g | 1141.84 Pln | |
| BLDpharm | 5g | 3796.47 Pln | |
| BLDpharm | 25g | 13509.71 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 3016.40 Pln | |
| Chemat | 25g | 10403.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol (CAS 2757097-49-5) is a chemical compound with the molecular formula C27H38BFO3Si and a molecular weight of 468.5 g/mol. IUPAC name: 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol. InChIKey: DALORNLWYBIYBQ-UHFFFAOYSA-N.
| Molecular formula | C27H38BFO3Si |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-ol |
| InChIKey | DALORNLWYBIYBQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C(=C(C=C3)F)C#C[Si](C(C)C)(C(C)C)C(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
C27H38BFO3Si