CAS 2589531-86-0 is the registry number for 6-Fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide dihydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide;dihydrochloride (CAS 2589531-86-0) is a chemical compound with the molecular formula C11H17Cl2FN4O and a molecular weight of 311.18 g/mol. IUPAC name: 6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide;dihydrochloride. InChIKey: QTTUNAUMSFRNFQ-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2FN4O |
|---|---|
| Molecular weight | 311.18 g/mol |
| IUPAC name | 6-fluoro-N-methyl-5-piperazin-1-ylpyridine-2-carboxamide;dihydrochloride |
| InChIKey | QTTUNAUMSFRNFQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC(=C(C=C1)N2CCNCC2)F.Cl.Cl |
Computed by PubChem (NCBI)