cas: 99455-01-3 — see every product listed under this CAS number, including other names
6-Iodoquinolin-2-ol, ≥97-<99% (CAS 99455-01-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1379-97-99-25g |
| cas | 99455-01-3 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 5826.70 Pln | |
| Hoffman Fine Chemicals | 50g | 9131.54 Pln | |
| Hoffman Fine Chemicals | 100g | 14433.32 Pln | |
| Hoffman Fine Chemicals | 200g | 22899.58 Pln | |
| Hoffman Fine Chemicals | 300g | 30804.40 Pln | |
| Hoffman Fine Chemicals | 400g | 36903.68 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
6-iodo-1H-quinolin-2-one (CAS 99455-01-3) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 6-iodo-1H-quinolin-2-one. InChIKey: HRQARRHZNIORQE-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 6-iodo-1H-quinolin-2-one |
| InChIKey | HRQARRHZNIORQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)N2)C=C1I |
Computed by PubChem (NCBI)