cas: 1150114-41-2 — see every product listed under this CAS number, including other names
6-Methyl-2-(1-phenylvinyl)-1,3,6,2-dioxazaborocane, 95% (stabilized with TBC), 95% (stabilized with TBC) (CAS 1150114-41-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FLM-100mg |
| cas | 1150114-41-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 558.80 Pln |
| purity | 95% (stabilized with TBC) |
|---|---|
| delivery time | 3 weeks |
6-methyl-2-(1-phenylethenyl)-1,3,6,2-dioxazaborocane (CAS 1150114-41-2) is a chemical compound with the molecular formula C13H18BNO2 and a molecular weight of 231.10 g/mol. IUPAC name: 6-methyl-2-(1-phenylethenyl)-1,3,6,2-dioxazaborocane. InChIKey: QWPFMUGPSYWPFD-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO2 |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 6-methyl-2-(1-phenylethenyl)-1,3,6,2-dioxazaborocane |
| InChIKey | QWPFMUGPSYWPFD-UHFFFAOYSA-N |
| SMILES | B1(OCCN(CCO1)C)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)