cas: 22952-24-5 — see every product listed under this CAS number, including other names
6-Nitrobenzo[d]isothiazol-3(2H)-one 1,1-dioxide 95% (CAS 22952-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A433812-1g |
| cas | 22952-24-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 10g | 654.06 Pln | |
| Ambeed | 25g | 1410.56 Pln | |
| Ambeed | 100g | 4764.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A433812 |
6-nitro-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22952-24-5) is a chemical compound with the molecular formula C7H4N2O5S and a molecular weight of 228.18 g/mol. IUPAC name: 6-nitro-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: HZZFBUZSKAVIOV-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O5S |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | 6-nitro-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | HZZFBUZSKAVIOV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)