cas: 1178884-68-8 — see every product listed under this CAS number, including other names
6-Tert-butyl-3,4-dihydroisoquinolin-1(2h)-one, 98%, 98% (CAS 1178884-68-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106PA-100mg |
| cas | 1178884-68-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 1490.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-tert-butyl-3,4-dihydro-2H-isoquinolin-1-one (CAS 1178884-68-8) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 6-tert-butyl-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: KVSRTYBIFKWHND-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 6-tert-butyl-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | KVSRTYBIFKWHND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)NCC2 |
Computed by PubChem (NCBI)