6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-ylpyridin-2-yl)amino]pyrido[2,3-d]pyrimidin-7-one hydrochloride, 98%, 98%
cas: 827022-32-2 — see every product listed under this CAS number, including other names
6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-ylpyridin-2-yl)amino]pyrido[2,3-d]pyrimidin-7-one hydrochloride, 98%, 98% (CAS 827022-32-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11403X-1mg |
| cas | 827022-32-2 |
| size | 1mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 5mg | 83.60 Pln | |
| Chemat | 10mg | 88.40 Pln | |
| Chemat | 50mg | 102.80 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 1029.20 Pln | |
| Chemat | 25g | 1576.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;hydrochloride (CAS 827022-32-2) is a chemical compound with the molecular formula C24H30ClN7O2 and a molecular weight of 484.0 g/mol. IUPAC name: 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;hydrochloride. InChIKey: STEQOHNDWONVIF-UHFFFAOYSA-N.
| Molecular formula | C24H30ClN7O2 |
|---|---|
| Molecular weight | 484.0 g/mol |
| IUPAC name | 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| InChIKey | STEQOHNDWONVIF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C(=O)C.Cl |
Computed by PubChem (NCBI)