cas: 1361825-47-9 — see every product listed under this CAS number, including other names
6-bromo-3-(trifluoromethoxy)pyridin-2-amine, 96%, 96% (CAS 1361825-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JV7Y-100mg |
| cas | 1361825-47-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2594.00 Pln | |
| Chemat | 250mg | 4106.00 Pln | |
| Chemat | 500mg | 6803.60 Pln | |
| Chemat | 1g | 10168.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-bromo-3-(trifluoromethoxy)pyridin-2-amine (CAS 1361825-47-9) is a chemical compound with the molecular formula C6H4BrF3N2O and a molecular weight of 257.01 g/mol. IUPAC name: 6-bromo-3-(trifluoromethoxy)pyridin-2-amine. InChIKey: DBTWPESSVVACOG-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 6-bromo-3-(trifluoromethoxy)pyridin-2-amine |
| InChIKey | DBTWPESSVVACOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1OC(F)(F)F)N)Br |
Computed by PubChem (NCBI)