cas: 958649-15-5 — see every product listed under this CAS number, including other names
6-bromo-4-oxo-1,4-dihydroquinoline-3-carbonitrile, 96% (CAS 958649-15-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F356016-250MG |
| cas | 958649-15-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 3423.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-4-oxo-1H-quinoline-3-carbonitrile (CAS 958649-15-5) is a chemical compound with the molecular formula C10H5BrN2O and a molecular weight of 249.06 g/mol. IUPAC name: 6-bromo-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: HEKLYXFAPJNHEX-UHFFFAOYSA-N.
| Molecular formula | C10H5BrN2O |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 6-bromo-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | HEKLYXFAPJNHEX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=CN2)C#N |
Computed by PubChem (NCBI)