cas: 203626-38-4 — see every product listed under this CAS number, including other names
6-chloro-8-methyl-1,4-dihydroquinolin-4-one, 98% (CAS 203626-38-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F752568-250MG |
| cas | 203626-38-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2215.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-chloro-8-methyl-1H-quinolin-4-one (CAS 203626-38-4) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 6-chloro-8-methyl-1H-quinolin-4-one. InChIKey: JXKDLLRAADOUNF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 6-chloro-8-methyl-1H-quinolin-4-one |
| InChIKey | JXKDLLRAADOUNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC=CC2=O)Cl |
Computed by PubChem (NCBI)