cas: 75413-98-8 — see every product listed under this CAS number, including other names
6-tert-Butyl-1,2,3,4-tetrahydroquinoline, 97%, 97% (CAS 75413-98-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GA0I-25mg |
| cas | 75413-98-8 |
| size | 25mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 261.20 Pln | |
| Chemat | 50mg | 395.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-tert-butyl-1,2,3,4-tetrahydroquinoline (CAS 75413-98-8) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 6-tert-butyl-1,2,3,4-tetrahydroquinoline. InChIKey: CVUAEQKDQXZBLD-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 6-tert-butyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | CVUAEQKDQXZBLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NCCC2 |
Computed by PubChem (NCBI)