cas: 178984-37-7 — see every product listed under this CAS number, including other names
7,8-dimethyl-1,4-dihydroquinolin-4-one, 97% (CAS 178984-37-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F640616-250MG |
| cas | 178984-37-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1153.78 Pln | |
| Fluorochem | 1g | 3101.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7,8-dimethyl-1H-quinolin-4-one (CAS 178984-37-7) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 7,8-dimethyl-1H-quinolin-4-one. InChIKey: WNBSNWXFDDNXMY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 7,8-dimethyl-1H-quinolin-4-one |
| InChIKey | WNBSNWXFDDNXMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C=CN2)C |
Computed by PubChem (NCBI)