cas: 1187933-12-5 — see every product listed under this CAS number, including other names
7–Bromo–1–methylquinolin–2(1H)–one (CAS 1187933-12-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF18399-100mg |
| cas | 1187933-12-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 826.38 Pln | |
| GLPBio | 1g | 2052.68 Pln | |
| GLPBio | 250mg | 1069.77 Pln | |
| GLPBio | 5g | 3938.92 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-1-methylquinolin-2-one (CAS 1187933-12-5) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromo-1-methylquinolin-2-one. InChIKey: NUHIBWXANVPRAN-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromo-1-methylquinolin-2-one |
| InChIKey | NUHIBWXANVPRAN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=CC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)