7–Iodo–2',3'–dideoxy–7–deaza–guanosine
cas: 114748-67-3 — see every product listed under this CAS number, including other names
7–Iodo–2',3'–dideoxy–7–deaza–guanosine (CAS 114748-67-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC66060-10 |
| cas | 114748-67-3 |
| size | 10mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 690.65 Pln | |
| GLPBio | 100mg | 1828.01 Pln | |
| GLPBio | 25mg | 962.12 Pln | |
| GLPBio | 5mg | 583.00 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 601.72 Pln | |
| GLPBio | 50mg | 1299.11 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 114748-67-3) is a chemical compound with the molecular formula C11H13IN4O3 and a molecular weight of 376.15 g/mol. IUPAC name: 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: KJNOBXXCZQLWLF-CAHLUQPWSA-N.
| Molecular formula | C11H13IN4O3 |
|---|---|
| Molecular weight | 376.15 g/mol |
| IUPAC name | 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | KJNOBXXCZQLWLF-CAHLUQPWSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CO)N2C=C(C3=C2N=C(NC3=O)N)I |
Computed by PubChem (NCBI)