cas: 19490-87-0 — see every product listed under this CAS number, including other names
7–Methoxy–2–methylquinoline (CAS 19490-87-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD17287-100mg |
| cas | 19490-87-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 704.69 Pln | |
| GLPBio | 1g | 1715.68 Pln | |
| GLPBio | 250mg | 919.99 Pln | |
| GLPBio | 5g | 6199.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
7-methoxy-2-methylquinoline (CAS 19490-87-0) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 7-methoxy-2-methylquinoline. InChIKey: QEVADHKTNBIYSD-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 7-methoxy-2-methylquinoline |
| InChIKey | QEVADHKTNBIYSD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2)OC |
Computed by PubChem (NCBI)