cas: 56725-99-6 — see every product listed under this CAS number, including other names
7-(β-D-Glucopyranosyloxy)-3,5-dihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one, 98%, 98% (CAS 56725-99-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 20mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EI6U-1mg |
| cas | 56725-99-6 |
| size | 1mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 131.60 Pln | |
| Chemat | 5mg | 146.00 Pln | |
| Chemat | 10mg | 198.80 Pln | |
| Chemat | 20mg | 314.00 Pln | |
| Chemat | 25mg | 352.40 Pln | |
| Chemat | 50mg | 554.00 Pln | |
| Chemat | 100mg | 861.20 Pln | |
| Chemat | 250mg | 1480.40 Pln | |
| Chemat | 500mg | 2723.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one (CAS 56725-99-6) is a chemical compound with the molecular formula C27H30O11 and a molecular weight of 530.5 g/mol. IUPAC name: 3,5-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one. InChIKey: IYCPMVXIUPYNHI-WPKKLUCLSA-N.
| Molecular formula | C27H30O11 |
|---|---|
| Molecular weight | 530.5 g/mol |
| IUPAC name | 3,5-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| InChIKey | IYCPMVXIUPYNHI-WPKKLUCLSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)OC)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C |
Computed by PubChem (NCBI)