cas: 1219130-57-0 — see every product listed under this CAS number, including other names
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[b][1,4]oxazin-3(4H)-one 98% (CAS 1219130-57-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A462738-100mg |
| cas | 1219130-57-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A462738 |
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzoxazin-3-one (CAS 1219130-57-0) is a chemical compound with the molecular formula C14H18BNO4 and a molecular weight of 275.11 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzoxazin-3-one. InChIKey: SUGHRPQPOYIUBL-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO4 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzoxazin-3-one |
| InChIKey | SUGHRPQPOYIUBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NC(=O)CO3 |
Computed by PubChem (NCBI)