cas: 1228013-30-6 — see every product listed under this CAS number, including other names
7-(6-(2-Hydroxypropan-2-yl)pyridin-3-yl)-1-(trans-4-methoxycyclohexyl)-3,4-dihydropyrazino[2,3-b]pyrazin-2(1H)-one, 99%, 99% (CAS 1228013-30-6) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JHY-2mg |
| cas | 1228013-30-6 |
| size | 2mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 150.80 Pln | |
| Chemat | 5mg | 198.80 Pln | |
| Chemat | 10mg | 280.40 Pln | |
| Chemat | 25mg | 496.40 Pln | |
| Chemat | 50mg | 798.80 Pln | |
| Chemat | 100mg | 1312.40 Pln | |
| Chemat | 250mg | 2190.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-[6-(2-hydroxypropan-2-yl)-3-pyridinyl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (CAS 1228013-30-6) is a chemical compound with the molecular formula C21H27N5O3 and a molecular weight of 397.5 g/mol. IUPAC name: 3-[6-(2-hydroxypropan-2-yl)-3-pyridinyl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one. InChIKey: UFKLYTOEMRFKAD-UHFFFAOYSA-N.
| Molecular formula | C21H27N5O3 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 3-[6-(2-hydroxypropan-2-yl)-3-pyridinyl]-5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| InChIKey | UFKLYTOEMRFKAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC=C(C=C1)C2=CN=C3C(=N2)N(C(=O)CN3)C4CCC(CC4)OC)O |
Computed by PubChem (NCBI)