cas: 1365759-12-1 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)-3,4-dihydroisoquinolin-1(2H)-one, 97%, 97% (CAS 1365759-12-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11233V-100mg |
| cas | 1365759-12-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 1g | 2522.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-(trifluoromethyl)-3,4-dihydro-2H-isoquinolin-1-one (CAS 1365759-12-1) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 7-(trifluoromethyl)-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: PWZSJDNHPNHZMD-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | PWZSJDNHPNHZMD-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)