cas: 1101857-21-9 — see every product listed under this CAS number, including other names
7-(tert-Butyl) 3-ethyl 2-amino-5,6-dihydrothieno[2,3-b]pyridine-3,7(4H)-dicarboxylate, 97% (CAS 1101857-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614060-100MG |
| cas | 1101857-21-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1325.59 Pln | |
| Fluorochem | 250mg | 2064.92 Pln | |
| Fluorochem | 500mg | 3392.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-O-tert-butyl 3-O-ethyl 2-amino-5,6-dihydro-4H-thieno[2,3-b]pyridine-3,7-dicarboxylate (CAS 1101857-21-9) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 7-O-tert-butyl 3-O-ethyl 2-amino-5,6-dihydro-4H-thieno[2,3-b]pyridine-3,7-dicarboxylate. InChIKey: WBVQCUDNEXXBAC-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 7-O-tert-butyl 3-O-ethyl 2-amino-5,6-dihydro-4H-thieno[2,3-b]pyridine-3,7-dicarboxylate |
| InChIKey | WBVQCUDNEXXBAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCCN2C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)