cas: 1374258-30-6 — see every product listed under this CAS number, including other names
7-Bromo-1-methoxyisoquinoline, 98% (CAS 1374258-30-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 25g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1224871-5g |
| cas | 1374258-30-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3852.31 Pln | |
| AmBeed | 100mg | 447.58 Pln | |
| AmBeed | 25g | 11495.05 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 841.39 Pln | |
| Fluorochem | 5g | 2408.54 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-1-methoxyisoquinoline (CAS 1374258-30-6) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromo-1-methoxyisoquinoline. InChIKey: RNZQCNYQATWREI-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromo-1-methoxyisoquinoline |
| InChIKey | RNZQCNYQATWREI-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)