cas: 911056-05-8 — see every product listed under this CAS number, including other names
7-Bromo-2-chloro-6-methoxybenzo[d]thiazole 95% (CAS 911056-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198435-100mg |
| cas | 911056-05-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A198435 |
7-bromo-2-chloro-6-methoxy-1,3-benzothiazole (CAS 911056-05-8) is a chemical compound with the molecular formula C8H5BrClNOS and a molecular weight of 278.55 g/mol. IUPAC name: 7-bromo-2-chloro-6-methoxy-1,3-benzothiazole. InChIKey: CBDBYQQQJMRNSL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNOS |
|---|---|
| Molecular weight | 278.55 g/mol |
| IUPAC name | 7-bromo-2-chloro-6-methoxy-1,3-benzothiazole |
| InChIKey | CBDBYQQQJMRNSL-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)N=C(S2)Cl)Br |
Computed by PubChem (NCBI)