7-Bromo-2-methylisoquinolin-1(2H)-one, 95%
cas: 1290634-35-3 — see every product listed under this CAS number, including other names
7-Bromo-2-methylisoquinolin-1(2H)-one, 95% (CAS 1290634-35-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A646758-100mg |
| cas | 1290634-35-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1232.56 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 966.80 Pln | |
| BLDpharm | 100mg | 358.79 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 1325.11 Pln | |
| Fluorochem | 250mg | 716.43 Pln | |
| Fluorochem | 1g | 1788.97 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
7-bromo-2-methylisoquinolin-1-one (CAS 1290634-35-3) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromo-2-methylisoquinolin-1-one. InChIKey: ZZSFZIKRCCTBSV-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromo-2-methylisoquinolin-1-one |
| InChIKey | ZZSFZIKRCCTBSV-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)