cas: 56716-92-8 — see every product listed under this CAS number, including other names
7-Bromo-2-methylquinolin-4-ol, 95+%, 95+% (CAS 56716-92-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBDY-100mg |
| cas | 56716-92-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1422.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
7-bromo-2-methyl-1H-quinolin-4-one (CAS 56716-92-8) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromo-2-methyl-1H-quinolin-4-one. InChIKey: QOUCHADNJZFETE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromo-2-methyl-1H-quinolin-4-one |
| InChIKey | QOUCHADNJZFETE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C=C(C=C2)Br |
Computed by PubChem (NCBI)