cas: 1260903-12-5 — see every product listed under this CAS number, including other names
7-Bromo-5-chlorobenzo[d]isoxazole, 97%, 97% (CAS 1260903-12-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RKZ-100mg |
| cas | 1260903-12-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-5-chloro-1,2-benzoxazole (CAS 1260903-12-5) is a chemical compound with the molecular formula C7H3BrClNO and a molecular weight of 232.46 g/mol. IUPAC name: 7-bromo-5-chloro-1,2-benzoxazole. InChIKey: HCDGSNNVDFZCJI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 7-bromo-5-chloro-1,2-benzoxazole |
| InChIKey | HCDGSNNVDFZCJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NO2)Br)Cl |
Computed by PubChem (NCBI)