cas: 105679-33-2 — see every product listed under this CAS number, including other names
7-Bromo-6-chloro-3,4-dihydro-2H-benzo[b][1,4]oxazine 97% (CAS 105679-33-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1002287-50mg |
| cas | 105679-33-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 331.44 Pln | |
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1844.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1002287 |
7-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine (CAS 105679-33-2) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 7-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: BAUAOJVZMYGURE-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 7-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | BAUAOJVZMYGURE-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2N1)Cl)Br |
Computed by PubChem (NCBI)