cas: 20358-05-8 — see every product listed under this CAS number, including other names
7-Bromobenzo[d]thiazol-2-amine, 96%, 96% (CAS 20358-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11301G-100mg |
| cas | 20358-05-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 5g | 2766.80 Pln | |
| Chemat | 10g | 4658.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1,3-benzothiazol-2-amine (CAS 20358-05-8) is a chemical compound with the molecular formula C7H5BrN2S and a molecular weight of 229.10 g/mol. IUPAC name: 7-bromo-1,3-benzothiazol-2-amine. InChIKey: YHKASBDRJLTLHH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2S |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 7-bromo-1,3-benzothiazol-2-amine |
| InChIKey | YHKASBDRJLTLHH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)SC(=N2)N |
Computed by PubChem (NCBI)