cas: 119011-56-2 — see every product listed under this CAS number, including other names
7-Chloro-2-(methylthio)thiazolo(4,5-d)pyrimidine, 95+% (CAS 119011-56-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A734161-5g |
| cas | 119011-56-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 20296.57 Pln | |
| AmBeed | 10g | 35783.86 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine (CAS 119011-56-2) is a chemical compound with the molecular formula C6H4ClN3S2 and a molecular weight of 217.7 g/mol. IUPAC name: 7-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine. InChIKey: QWLDSUKDTJSCCY-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3S2 |
|---|---|
| Molecular weight | 217.7 g/mol |
| IUPAC name | 7-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine |
| InChIKey | QWLDSUKDTJSCCY-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)