cas: 871125-83-6 — see every product listed under this CAS number, including other names
7-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline 98% (CAS 871125-83-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452726-250mg |
| cas | 871125-83-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 25g | 6355.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A452726 |
7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 871125-83-6) is a chemical compound with the molecular formula C15H17BClNO2 and a molecular weight of 289.6 g/mol. IUPAC name: 7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: GZDUYRAAWRRVEY-UHFFFAOYSA-N.
| Molecular formula | C15H17BClNO2 |
|---|---|
| Molecular weight | 289.6 g/mol |
| IUPAC name | 7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | GZDUYRAAWRRVEY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC(=CC3=NC=C2)Cl |
Computed by PubChem (NCBI)